C11H18O2 — CID 142585808
(3Z)-2-methoxy-4-(1-methoxyethenyl)hepta-1,3-diene (PubChem CID 142585808) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (3Z)-2-methoxy-4-(1-methoxyethenyl)hepta-1,3-diene.
| Compound Name | (3Z)-2-methoxy-4-(1-methoxyethenyl)hepta-1,3-diene |
|---|---|
| PubChem CID | 142585808 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (3Z)-2-methoxy-4-(1-methoxyethenyl)hepta-1,3-diene |
| SMILES | C=C(/C=C(/CCC)C(=C)OC)OC |
| InChI | InChI=1S/C11H18O2/c1-6-7-11(10(3)13-5)8-9(2)12-4/h8H,2-3,6-7H2,1,4-5H3/b11-8- |
| InChIKey | KVHGOGATPRYTFA-FLIBITNWSA-N |
| XLogP | 3.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|