C8H8F4O2 — CID 177209308
(3E)-3-fluoro-5-methoxy-2-(trifluoromethoxy)hexa-1,3,5-triene (PubChem CID 177209308) has the molecular formula C8H8F4O2 and a molecular weight of 212.14 g/mol. Its IUPAC name is (3E)-3-fluoro-5-methoxy-2-(trifluoromethoxy)hexa-1,3,5-triene.
| Compound Name | (3E)-3-fluoro-5-methoxy-2-(trifluoromethoxy)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 177209308 |
| Molecular Formula | C8H8F4O2 |
| Molecular Weight | 212.14 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | (3E)-3-fluoro-5-methoxy-2-(trifluoromethoxy)hexa-1,3,5-triene |
| SMILES | C=C(/C=C(/F)C(=C)OC(F)(F)F)OC |
| InChI | InChI=1S/C8H8F4O2/c1-5(13-3)4-7(9)6(2)14-8(10,11)12/h4H,1-2H2,3H3/b7-4+ |
| InChIKey | WAMPNUCBRKHSIE-QPJJXVBHSA-N |
| XLogP | 3.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.14 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|