C9H10F4O — CID 135268108
(3Z,5E)-2-fluoro-3-methyl-5-(trifluoromethoxy)hepta-1,3,5-triene (PubChem CID 135268108) has the molecular formula C9H10F4O and a molecular weight of 210.17 g/mol. Its IUPAC name is (3Z,5E)-2-fluoro-3-methyl-5-(trifluoromethoxy)hepta-1,3,5-triene.
| Compound Name | (3Z,5E)-2-fluoro-3-methyl-5-(trifluoromethoxy)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 135268108 |
| Molecular Formula | C9H10F4O |
| Molecular Weight | 210.17 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | (3Z,5E)-2-fluoro-3-methyl-5-(trifluoromethoxy)hepta-1,3,5-triene |
| SMILES | C=C(F)/C(C)=C\C(=C/C)OC(F)(F)F |
| InChI | InChI=1S/C9H10F4O/c1-4-8(14-9(11,12)13)5-6(2)7(3)10/h4-5H,3H2,1-2H3/b6-5-,8-4+ |
| InChIKey | SZZSNTGKZDPVDL-QNMAEOQASA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.17 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|