C16H21F3N2O — CID 118233780
N'-[(6Z,8E)-5-methylidene-8-(trifluoromethoxy)deca-1,6,8-trien-2-yl]-N-propan-2-ylidenemethanimidamide (PubChem CID 118233780) has the molecular formula C16H21F3N2O and a molecular weight of 314.35 g/mol. Its IUPAC name is N'-[(6Z,8E)-5-methylidene-8-(trifluoromethoxy)deca-1,6,8-trien-2-yl]-N-propan-2-ylidenemethanimidamide.
| Compound Name | N'-[(6Z,8E)-5-methylidene-8-(trifluoromethoxy)deca-1,6,8-trien-2-yl]-N-propan-2-ylidenemethanimidamide |
|---|---|
| PubChem CID | 118233780 |
| Molecular Formula | C16H21F3N2O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N'-[(6Z,8E)-5-methylidene-8-(trifluoromethoxy)deca-1,6,8-trien-2-yl]-N-propan-2-ylidenemethanimidamide |
| SMILES | C=C(/C=C\C(=C/C)OC(F)(F)F)CCC(=C)/N=C/N=C(C)C |
| InChI | InChI=1S/C16H21F3N2O/c1-6-15(22-16(17,18)19)10-8-13(4)7-9-14(5)21-11-20-12(2)3/h6,8,10-11H,4-5,7,9H2,1-3H3/b10-8-,15-6+,21-11+ |
| InChIKey | FWOFIQRLBOXPTA-FFVZMCJYSA-N |
| XLogP | 5.34 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|