C10H16OS — CID 166777674
(3Z,5E)-5-methoxy-2-(methylsulfanylmethyl)hepta-1,3,5-triene (PubChem CID 166777674) has the molecular formula C10H16OS and a molecular weight of 184.30 g/mol. Its IUPAC name is (3Z,5E)-5-methoxy-2-(methylsulfanylmethyl)hepta-1,3,5-triene.
| Compound Name | (3Z,5E)-5-methoxy-2-(methylsulfanylmethyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 166777674 |
| Molecular Formula | C10H16OS |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | (3Z,5E)-5-methoxy-2-(methylsulfanylmethyl)hepta-1,3,5-triene |
| SMILES | C=C(/C=C\C(=C/C)OC)CSC |
| InChI | InChI=1S/C10H16OS/c1-5-10(11-3)7-6-9(2)8-12-4/h5-7H,2,8H2,1,3-4H3/b7-6-,10-5+ |
| InChIKey | LDVXPSKHYUZEQY-JQEGGOPCSA-N |
| XLogP | 3.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|