C14H24O — CID 145179802
(4Z,6E)-3-tert-butyl-6-methoxy-3-methylocta-1,4,6-triene (PubChem CID 145179802) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (4Z,6E)-3-tert-butyl-6-methoxy-3-methylocta-1,4,6-triene.
| Compound Name | (4Z,6E)-3-tert-butyl-6-methoxy-3-methylocta-1,4,6-triene |
|---|---|
| PubChem CID | 145179802 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (4Z,6E)-3-tert-butyl-6-methoxy-3-methylocta-1,4,6-triene |
| SMILES | C=CC(C)(/C=C\C(=C/C)OC)C(C)(C)C |
| InChI | InChI=1S/C14H24O/c1-8-12(15-7)10-11-14(6,9-2)13(3,4)5/h8-11H,2H2,1,3-7H3/b11-10-,12-8+ |
| InChIKey | CWTDPXRKAHIIRU-WROCRQLKSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|