C11H18O — CID 177034485
(4Z,6E)-6-methoxy-2,3-dimethylocta-2,4,6-triene (PubChem CID 177034485) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (4Z,6E)-6-methoxy-2,3-dimethylocta-2,4,6-triene.
| Compound Name | (4Z,6E)-6-methoxy-2,3-dimethylocta-2,4,6-triene |
|---|---|
| PubChem CID | 177034485 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (4Z,6E)-6-methoxy-2,3-dimethylocta-2,4,6-triene |
| SMILES | C/C=C(\C=C/C(C)=C(C)C)OC |
| InChI | InChI=1S/C11H18O/c1-6-11(12-5)8-7-10(4)9(2)3/h6-8H,1-5H3/b8-7-,11-6+ |
| InChIKey | IVRHIZVJSHEBHH-YKFSIMETSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|