C9H19N — CID 144535129
(1Z)-3,4-dimethylpenta-1,3-dien-1-amine;ethane (PubChem CID 144535129) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is (1Z)-3,4-dimethylpenta-1,3-dien-1-amine;ethane.
| Compound Name | (1Z)-3,4-dimethylpenta-1,3-dien-1-amine;ethane |
|---|---|
| PubChem CID | 144535129 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | (1Z)-3,4-dimethylpenta-1,3-dien-1-amine;ethane |
| SMILES | CC.CC(C)=C(C)/C=C\N |
| InChI | InChI=1S/C7H13N.C2H6/c1-6(2)7(3)4-5-8;1-2/h4-5H,8H2,1-3H3;1-2H3/b5-4-; |
| InChIKey | AWDDLEHDXNMNRP-MKWAYWHRSA-N |
| XLogP | 2.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|