About (Z)-3-amino-N-methylprop-2-enimidoyl chloride;ethane
(Z)-3-amino-N-methylprop-2-enimidoyl chloride;ethane (PubChem CID 143705298) has the molecular formula C8H19ClN2
and a molecular weight of 178.71 g/mol. Its IUPAC name is (Z)-3-amino-N-methylprop-2-enimidoyl chloride;ethane.
Molecular Properties
| Compound Name | (Z)-3-amino-N-methylprop-2-enimidoyl chloride;ethane |
| PubChem CID | 143705298 |
| Molecular Formula | C8H19ClN2 |
| Molecular Weight | 178.71 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | (Z)-3-amino-N-methylprop-2-enimidoyl chloride;ethane |
| SMILES | C/N=C(Cl)/C=C\N.CC.CC |
| InChI | InChI=1S/C4H7ClN2.2C2H6/c1-7-4(5)2-3-6;2*1-2/h2-3H,6H2,1H3;2*1-2H3/b3-2-,7-4-;; |
| InChIKey | RQQPWTDSRMCTQP-LYDBPSPDSA-N |
| XLogP | 2.78 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.71 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-amino-N-methylprop-2-enimidoyl chloride;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-amino-N-methylprop-2-enimidoyl chloride;ethane?
The IUPAC name of (Z)-3-amino-N-methylprop-2-enimidoyl chloride;ethane (CID 143705298) is (Z)-3-amino-N-methylprop-2-enimidoyl chloride;ethane.
What is the SMILES notation for (Z)-3-amino-N-methylprop-2-enimidoyl chloride;ethane?
The canonical SMILES for (Z)-3-amino-N-methylprop-2-enimidoyl chloride;ethane is C/N=C(Cl)/C=C\N.CC.CC.
What is the InChIKey of (Z)-3-amino-N-methylprop-2-enimidoyl chloride;ethane?
The InChIKey is RQQPWTDSRMCTQP-LYDBPSPDSA-N. The full InChI is InChI=1S/C4H7ClN2.2C2H6/c1-7-4(5)2-3-6;2*1-2/h2-3H,6H2,1H3;2*1-2H3/b3-2-,7-4-;;.
What are the key properties of (Z)-3-amino-N-methylprop-2-enimidoyl chloride;ethane?
(Z)-3-amino-N-methylprop-2-enimidoyl chloride;ethane has a molecular weight of 178.71 g/mol, XLogP of 2.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-amino-N-methylprop-2-enimidoyl chloride;ethane is sourced from PubChem (CID 143705298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).