C10H19BN2O2 — CID 146797377
3-methylimino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-1-amine (PubChem CID 146797377) has the molecular formula C10H19BN2O2 and a molecular weight of 210.09 g/mol. Its IUPAC name is 3-methylimino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-1-amine.
| Compound Name | 3-methylimino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 146797377 |
| Molecular Formula | C10H19BN2O2 |
| Molecular Weight | 210.09 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 3-methylimino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-1-amine |
| SMILES | C/N=C(\C=CN)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H19BN2O2/c1-9(2)10(3,4)15-11(14-9)8(13-5)6-7-12/h6-7H,12H2,1-5H3/b7-6?,13-8+ |
| InChIKey | MOBCXZKYXKHMBF-KAORETLCSA-N |
| XLogP | 1.16 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.09 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|