C12H22BNO2 — CID 147652041
(1Z,3E)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-1,3-dien-1-amine (PubChem CID 147652041) has the molecular formula C12H22BNO2 and a molecular weight of 223.12 g/mol. Its IUPAC name is (1Z,3E)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 147652041 |
| Molecular Formula | C12H22BNO2 |
| Molecular Weight | 223.12 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | (1Z,3E)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-1,3-dien-1-amine |
| SMILES | C/C=C/C(=C\NC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H22BNO2/c1-7-8-10(9-14-6)13-15-11(2,3)12(4,5)16-13/h7-9,14H,1-6H3/b8-7+,10-9+ |
| InChIKey | GJRPRSARDFXNSF-XBLVEGMJSA-N |
| XLogP | 2.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.12 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|