C10H21BN2O2 — CID 142517046
N-[(Z)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propylideneamino]methanamine (PubChem CID 142517046) has the molecular formula C10H21BN2O2 and a molecular weight of 212.10 g/mol. Its IUPAC name is N-[(Z)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propylideneamino]methanamine.
| Compound Name | N-[(Z)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propylideneamino]methanamine |
|---|---|
| PubChem CID | 142517046 |
| Molecular Formula | C10H21BN2O2 |
| Molecular Weight | 212.10 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | N-[(Z)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propylideneamino]methanamine |
| SMILES | CC/C(=N\NC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H21BN2O2/c1-7-8(13-12-6)11-14-9(2,3)10(4,5)15-11/h12H,7H2,1-6H3/b13-8+ |
| InChIKey | GIQIVXMTXOSZCI-MDWZMJQESA-N |
| XLogP | 1.60 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.10 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|