C11H23BN2O2 — CID 144665195
(Z)-1-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-ene-1,3-diamine (PubChem CID 144665195) has the molecular formula C11H23BN2O2 and a molecular weight of 226.13 g/mol. Its IUPAC name is (Z)-1-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-ene-1,3-diamine.
| Compound Name | (Z)-1-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-ene-1,3-diamine |
|---|---|
| PubChem CID | 144665195 |
| Molecular Formula | C11H23BN2O2 |
| Molecular Weight | 226.13 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | (Z)-1-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-ene-1,3-diamine |
| SMILES | CNC/C(B1OC(C)(C)C(C)(C)O1)=C(/C)N |
| InChI | InChI=1S/C11H23BN2O2/c1-8(13)9(7-14-6)12-15-10(2,3)11(4,5)16-12/h14H,7,13H2,1-6H3/b9-8+ |
| InChIKey | UCPFMMFTYUWJTL-CMDGGOBGSA-N |
| XLogP | 1.07 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.13 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|