C13H22BNO2 — CID 89033689
(2E,4Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,4,6-trien-2-amine (PubChem CID 89033689) has the molecular formula C13H22BNO2 and a molecular weight of 235.14 g/mol. Its IUPAC name is (2E,4Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,4,6-trien-2-amine.
| Compound Name | (2E,4Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 89033689 |
| Molecular Formula | C13H22BNO2 |
| Molecular Weight | 235.14 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | (2E,4Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,4,6-trien-2-amine |
| SMILES | C=C/C(=C\C=C(/C)N)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H22BNO2/c1-7-11(9-8-10(2)15)14-16-12(3,4)13(5,6)17-14/h7-9H,1,15H2,2-6H3/b10-8+,11-9+ |
| InChIKey | OYFYPCKUYVPMKD-GFULKKFKSA-N |
| XLogP | 2.59 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.14 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|