C12H19BO3W — CID 145384664
(2Z,4Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexa-2,4-dienal;tungsten (PubChem CID 145384664) has the molecular formula C12H19BO3W and a molecular weight of 405.93 g/mol. Its IUPAC name is (2Z,4Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexa-2,4-dienal;tungsten.
| Compound Name | (2Z,4Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexa-2,4-dienal;tungsten |
|---|---|
| PubChem CID | 145384664 |
| Molecular Formula | C12H19BO3W |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | (2Z,4Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexa-2,4-dienal;tungsten |
| SMILES | C/C=C\C(=C/C=O)B1OC(C)(C)C(C)(C)O1.[W] |
| InChI | InChI=1S/C12H19BO3.W/c1-6-7-10(8-9-14)13-15-11(2,3)12(4,5)16-13;/h6-9H,1-5H3;/b7-6-,10-8+; |
| InChIKey | OQKGEOCRYJVTFU-ZGSKTAACSA-N |
| XLogP | 2.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|