C17H30BNO3 — CID 129317517
N-tert-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,4-dienamide (PubChem CID 129317517) has the molecular formula C17H30BNO3 and a molecular weight of 307.24 g/mol. Its IUPAC name is N-tert-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,4-dienamide.
| Compound Name | N-tert-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,4-dienamide |
|---|---|
| PubChem CID | 129317517 |
| Molecular Formula | C17H30BNO3 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | N-tert-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,4-dienamide |
| SMILES | CCC=C(C=CC(=O)NC(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H30BNO3/c1-9-10-13(11-12-14(20)19-15(2,3)4)18-21-16(5,6)17(7,8)22-18/h10-12H,9H2,1-8H3,(H,19,20) |
| InChIKey | IYJSOXWKPVGFOQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|