C13H23BO4 — CID 123614658
methyl 2,2-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoate (PubChem CID 123614658) has the molecular formula C13H23BO4 and a molecular weight of 254.13 g/mol. Its IUPAC name is methyl 2,2-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoate.
| Compound Name | methyl 2,2-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoate |
|---|---|
| PubChem CID | 123614658 |
| Molecular Formula | C13H23BO4 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | methyl 2,2-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoate |
| SMILES | COC(=O)C(C)(C)C=CB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H23BO4/c1-11(2,10(15)16-7)8-9-14-17-12(3,4)13(5,6)18-14/h8-9H,1-7H3 |
| InChIKey | QPSFEYWJMDUMMX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|