C18H27BO6 — CID 102415851
dimethyl 3-methyl-4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]cyclopent-3-ene-1,1-dicarboxylate (PubChem CID 102415851) has the molecular formula C18H27BO6 and a molecular weight of 350.22 g/mol. Its IUPAC name is dimethyl 3-methyl-4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]cyclopent-3-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-methyl-4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]cyclopent-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102415851 |
| Molecular Formula | C18H27BO6 |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | dimethyl 3-methyl-4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]cyclopent-3-ene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(C)=C(/C=C/B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C18H27BO6/c1-12-10-18(14(20)22-6,15(21)23-7)11-13(12)8-9-19-24-16(2,3)17(4,5)25-19/h8-9H,10-11H2,1-7H3/b9-8+ |
| InChIKey | UBZWJVABKMYRDT-CMDGGOBGSA-N |
| XLogP | 2.62 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|