C16H25BN2O4S — CID 162744050
tert-butyl N-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 162744050) has the molecular formula C16H25BN2O4S and a molecular weight of 352.27 g/mol. Its IUPAC name is tert-butyl N-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 162744050 |
| Molecular Formula | C16H25BN2O4S |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | tert-butyl N-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(/C=C/B2OC(C)(C)C(C)(C)O2)cs1 |
| InChI | InChI=1S/C16H25BN2O4S/c1-14(2,3)21-13(20)19-12-18-11(10-24-12)8-9-17-22-15(4,5)16(6,7)23-17/h8-10H,1-7H3,(H,18,19,20)/b9-8+ |
| InChIKey | CRPXLHNTWXPCDD-CMDGGOBGSA-N |
| XLogP | 4.13 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|