C11H20BO3 — CID 155885641
CID 155885641 (PubChem CID 155885641) has the molecular formula C11H20BO3 and a molecular weight of 211.09 g/mol.
| Compound Name | CID 155885641 |
|---|---|
| PubChem CID | 155885641 |
| Molecular Formula | C11H20BO3 |
| Molecular Weight | 211.09 g/mol |
| Exact Mass | 211.15 |
| IUPAC Name | — |
| SMILES | [CH2]C(C)(O)/C=C/B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C11H20BO3/c1-9(2,13)7-8-12-14-10(3,4)11(5,6)15-12/h7-8,13H,1H2,2-6H3/b8-7+ |
| InChIKey | WBFKUMJQYBBQRU-BQYQJAHWSA-N |
| XLogP | 1.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.09 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|