C28H48B2O4S — CID 144649662
ethane;4,4,5,5-tetramethyl-2-[(E)-3-methyl-3-[5-[(E)-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-yl]thiophen-2-yl]but-1-enyl]-1,3,2-dioxaborolane (PubChem CID 144649662) has the molecular formula C28H48B2O4S and a molecular weight of 502.38 g/mol. Its IUPAC name is ethane;4,4,5,5-tetramethyl-2-[(E)-3-methyl-3-[5-[(E)-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-yl]thiophen-2-yl]but-1-enyl]-1,3,2-dioxaborolane.
| Compound Name | ethane;4,4,5,5-tetramethyl-2-[(E)-3-methyl-3-[5-[(E)-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-yl]thiophen-2-yl]but-1-enyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 144649662 |
| Molecular Formula | C28H48B2O4S |
| Molecular Weight | 502.38 g/mol |
| Exact Mass | 502.35 |
| IUPAC Name | ethane;4,4,5,5-tetramethyl-2-[(E)-3-methyl-3-[5-[(E)-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-yl]thiophen-2-yl]but-1-enyl]-1,3,2-dioxaborolane |
| SMILES | CC.CC(C)(/C=C/B1OC(C)(C)C(C)(C)O1)c1ccc(C(C)(C)/C=C/B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C26H42B2O4S.C2H6/c1-21(2,15-17-27-29-23(5,6)24(7,8)30-27)19-13-14-20(33-19)22(3,4)16-18-28-31-25(9,10)26(11,12)32-28;1-2/h13-18H,1-12H3;1-2H3/b17-15+,18-16+; |
| InChIKey | CIUNYBNOEPXUMC-UZQGXGHZSA-N |
| XLogP | 7.70 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.38 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|