C11H16BNO2S — CID 165471184
5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-thiazole (PubChem CID 165471184) has the molecular formula C11H16BNO2S and a molecular weight of 237.13 g/mol. Its IUPAC name is 5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-thiazole.
| Compound Name | 5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 165471184 |
| Molecular Formula | C11H16BNO2S |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-thiazole |
| SMILES | CC1(C)OB(/C=C/c2cncs2)OC1(C)C |
| InChI | InChI=1S/C11H16BNO2S/c1-10(2)11(3,4)15-12(14-10)6-5-9-7-13-8-16-9/h5-8H,1-4H3/b6-5+ |
| InChIKey | ANDZYTWTRFZYGS-AATRIKPKSA-N |
| XLogP | 2.79 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|