C15H23BN2O2 — CID 74890181
N,2-dimethyl-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-3-amine (PubChem CID 74890181) has the molecular formula C15H23BN2O2 and a molecular weight of 274.17 g/mol. Its IUPAC name is N,2-dimethyl-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-3-amine.
| Compound Name | N,2-dimethyl-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 74890181 |
| Molecular Formula | C15H23BN2O2 |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N,2-dimethyl-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-3-amine |
| SMILES | CNc1ccc(/C=C/B2OC(C)(C)C(C)(C)O2)nc1C |
| InChI | InChI=1S/C15H23BN2O2/c1-11-13(17-6)8-7-12(18-11)9-10-16-19-14(2,3)15(4,5)20-16/h7-10,17H,1-6H3/b10-9+ |
| InChIKey | OULIHNYAZQAVHO-MDZDMXLPSA-N |
| XLogP | 3.08 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|