C14H19BN2O4 — CID 74888779
3-methyl-2-nitro-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine (PubChem CID 74888779) has the molecular formula C14H19BN2O4 and a molecular weight of 290.13 g/mol. Its IUPAC name is 3-methyl-2-nitro-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine.
| Compound Name | 3-methyl-2-nitro-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine |
|---|---|
| PubChem CID | 74888779 |
| Molecular Formula | C14H19BN2O4 |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 3-methyl-2-nitro-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine |
| SMILES | Cc1ccc(/C=C/B2OC(C)(C)C(C)(C)O2)nc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19BN2O4/c1-10-6-7-11(16-12(10)17(18)19)8-9-15-20-13(2,3)14(4,5)21-15/h6-9H,1-5H3/b9-8+ |
| InChIKey | UBFWORWUJUSRCA-CMDGGOBGSA-N |
| XLogP | 2.94 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|