C13H18BN3O4 — CID 74789362
4-nitro-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-3-amine (PubChem CID 74789362) has the molecular formula C13H18BN3O4 and a molecular weight of 291.12 g/mol. Its IUPAC name is 4-nitro-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-3-amine.
| Compound Name | 4-nitro-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 74789362 |
| Molecular Formula | C13H18BN3O4 |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 4-nitro-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-3-amine |
| SMILES | CC1(C)OB(/C=C/c2nccc([N+](=O)[O-])c2N)OC1(C)C |
| InChI | InChI=1S/C13H18BN3O4/c1-12(2)13(3,4)21-14(20-12)7-5-9-11(15)10(17(18)19)6-8-16-9/h5-8H,15H2,1-4H3/b7-5+ |
| InChIKey | LLTXWFJMJFOIEG-FNORWQNLSA-N |
| XLogP | 2.22 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|