C13H17BN2O4 — CID 74789389
3-nitro-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine (PubChem CID 74789389) has the molecular formula C13H17BN2O4 and a molecular weight of 276.10 g/mol. Its IUPAC name is 3-nitro-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine.
| Compound Name | 3-nitro-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine |
|---|---|
| PubChem CID | 74789389 |
| Molecular Formula | C13H17BN2O4 |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 3-nitro-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine |
| SMILES | CC1(C)OB(/C=C/c2ncccc2[N+](=O)[O-])OC1(C)C |
| InChI | InChI=1S/C13H17BN2O4/c1-12(2)13(3,4)20-14(19-12)8-7-10-11(16(17)18)6-5-9-15-10/h5-9H,1-4H3/b8-7+ |
| InChIKey | ODDZXYSGSTVGLI-BQYQJAHWSA-N |
| XLogP | 2.63 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|