C13H17BFNO3 — CID 57416696
4-fluoro-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-3-ol (PubChem CID 57416696) has the molecular formula C13H17BFNO3 and a molecular weight of 265.09 g/mol. Its IUPAC name is 4-fluoro-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-3-ol.
| Compound Name | 4-fluoro-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-3-ol |
|---|---|
| PubChem CID | 57416696 |
| Molecular Formula | C13H17BFNO3 |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 4-fluoro-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-3-ol |
| SMILES | CC1(C)OB(/C=C/c2nccc(F)c2O)OC1(C)C |
| InChI | InChI=1S/C13H17BFNO3/c1-12(2)13(3,4)19-14(18-12)7-5-10-11(17)9(15)6-8-16-10/h5-8,17H,1-4H3/b7-5+ |
| InChIKey | IKYZRGFBLKTGMQ-FNORWQNLSA-N |
| XLogP | 2.57 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|