C14H17BBrFO3 — CID 175521175
4-bromo-2-fluoro-6-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenol (PubChem CID 175521175) has the molecular formula C14H17BBrFO3 and a molecular weight of 343.00 g/mol. Its IUPAC name is 4-bromo-2-fluoro-6-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenol.
| Compound Name | 4-bromo-2-fluoro-6-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenol |
|---|---|
| PubChem CID | 175521175 |
| Molecular Formula | C14H17BBrFO3 |
| Molecular Weight | 343.00 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 4-bromo-2-fluoro-6-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenol |
| SMILES | CC1(C)OB(C=Cc2cc(Br)cc(F)c2O)OC1(C)C |
| InChI | InChI=1S/C14H17BBrFO3/c1-13(2)14(3,4)20-15(19-13)6-5-9-7-10(16)8-11(17)12(9)18/h5-8,18H,1-4H3 |
| InChIKey | KMBOJIZORSWQHX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.00 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|