C13H17BFNO2S — CID 74789057
5-fluoro-3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-pyridine-2-thione (PubChem CID 74789057) has the molecular formula C13H17BFNO2S and a molecular weight of 281.16 g/mol. Its IUPAC name is 5-fluoro-3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-pyridine-2-thione.
| Compound Name | 5-fluoro-3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-pyridine-2-thione |
|---|---|
| PubChem CID | 74789057 |
| Molecular Formula | C13H17BFNO2S |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 5-fluoro-3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-pyridine-2-thione |
| SMILES | CC1(C)OB(/C=C/c2cc(F)c[nH]c2=S)OC1(C)C |
| InChI | InChI=1S/C13H17BFNO2S/c1-12(2)13(3,4)18-14(17-12)6-5-9-7-10(15)8-16-11(9)19/h5-8H,1-4H3,(H,16,19)/b6-5+ |
| InChIKey | BSVDGHARJUBTCF-AATRIKPKSA-N |
| XLogP | 3.53 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|