C15H21BFNO2 — CID 74888595
3-fluoro-2,6-dimethyl-4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine (PubChem CID 74888595) has the molecular formula C15H21BFNO2 and a molecular weight of 277.15 g/mol. Its IUPAC name is 3-fluoro-2,6-dimethyl-4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine.
| Compound Name | 3-fluoro-2,6-dimethyl-4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine |
|---|---|
| PubChem CID | 74888595 |
| Molecular Formula | C15H21BFNO2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 3-fluoro-2,6-dimethyl-4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine |
| SMILES | Cc1cc(/C=C/B2OC(C)(C)C(C)(C)O2)c(F)c(C)n1 |
| InChI | InChI=1S/C15H21BFNO2/c1-10-9-12(13(17)11(2)18-10)7-8-16-19-14(3,4)15(5,6)20-16/h7-9H,1-6H3/b8-7+ |
| InChIKey | OALNHTLOOHKZSE-BQYQJAHWSA-N |
| XLogP | 3.48 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|