C16H25BN2O2 — CID 74890195
N,N,6-trimethyl-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-2-amine (PubChem CID 74890195) has the molecular formula C16H25BN2O2 and a molecular weight of 288.20 g/mol. Its IUPAC name is N,N,6-trimethyl-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-2-amine.
| Compound Name | N,N,6-trimethyl-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 74890195 |
| Molecular Formula | C16H25BN2O2 |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N,N,6-trimethyl-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-2-amine |
| SMILES | Cc1nc(N(C)C)ccc1/C=C/B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H25BN2O2/c1-12-13(8-9-14(18-12)19(6)7)10-11-17-20-15(2,3)16(4,5)21-17/h8-11H,1-7H3/b11-10+ |
| InChIKey | IKMGRLCMIRYPEL-ZHACJKMWSA-N |
| XLogP | 3.10 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|