C18H26BFO5 — CID 144699686
4-fluoro-3-methoxy-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzaldehyde;methoxymethane (PubChem CID 144699686) has the molecular formula C18H26BFO5 and a molecular weight of 352.21 g/mol. Its IUPAC name is 4-fluoro-3-methoxy-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzaldehyde;methoxymethane.
| Compound Name | 4-fluoro-3-methoxy-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzaldehyde;methoxymethane |
|---|---|
| PubChem CID | 144699686 |
| Molecular Formula | C18H26BFO5 |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 4-fluoro-3-methoxy-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzaldehyde;methoxymethane |
| SMILES | COC.COc1cc(C=O)cc(/C=C/B2OC(C)(C)C(C)(C)O2)c1F |
| InChI | InChI=1S/C16H20BFO4.C2H6O/c1-15(2)16(3,4)22-17(21-15)7-6-12-8-11(10-19)9-13(20-5)14(12)18;1-3-2/h6-10H,1-5H3;1-2H3/b7-6+; |
| InChIKey | IUDPAWRQEWRARJ-UHDJGPCESA-N |
| XLogP | 3.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|