C13H16BF3N2O2 — CID 166595394
5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-(trifluoromethyl)pyrimidine (PubChem CID 166595394) has the molecular formula C13H16BF3N2O2 and a molecular weight of 300.09 g/mol. Its IUPAC name is 5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-(trifluoromethyl)pyrimidine.
| Compound Name | 5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 166595394 |
| Molecular Formula | C13H16BF3N2O2 |
| Molecular Weight | 300.09 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-(trifluoromethyl)pyrimidine |
| SMILES | CC1(C)OB(/C=C/c2cnc(C(F)(F)F)nc2)OC1(C)C |
| InChI | InChI=1S/C13H16BF3N2O2/c1-11(2)12(3,4)21-14(20-11)6-5-9-7-18-10(19-8-9)13(15,16)17/h5-8H,1-4H3/b6-5+ |
| InChIKey | JDFYDEXZROTMCO-AATRIKPKSA-N |
| XLogP | 3.14 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.09 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|