C15H20BNO4 — CID 74789032
2-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-pyridinyl]acetic acid (PubChem CID 74789032) has the molecular formula C15H20BNO4 and a molecular weight of 289.14 g/mol. Its IUPAC name is 2-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-pyridinyl]acetic acid.
| Compound Name | 2-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 74789032 |
| Molecular Formula | C15H20BNO4 |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-pyridinyl]acetic acid |
| SMILES | CC1(C)OB(/C=C/c2ccnc(CC(=O)O)c2)OC1(C)C |
| InChI | InChI=1S/C15H20BNO4/c1-14(2)15(3,4)21-16(20-14)7-5-11-6-8-17-12(9-11)10-13(18)19/h5-9H,10H2,1-4H3,(H,18,19)/b7-5+ |
| InChIKey | SQNUGFYBNFRBGH-FNORWQNLSA-N |
| XLogP | 2.35 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|