C16H24BNO2 — CID 57416755
4-propyl-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine (PubChem CID 57416755) has the molecular formula C16H24BNO2 and a molecular weight of 273.18 g/mol. Its IUPAC name is 4-propyl-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine.
| Compound Name | 4-propyl-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine |
|---|---|
| PubChem CID | 57416755 |
| Molecular Formula | C16H24BNO2 |
| Molecular Weight | 273.18 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | 4-propyl-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine |
| SMILES | CCCc1ccnc(/C=C/B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C16H24BNO2/c1-6-7-13-9-11-18-14(12-13)8-10-17-19-15(2,3)16(4,5)20-17/h8-12H,6-7H2,1-5H3/b10-8+ |
| InChIKey | MDTFRWBWIZRDSJ-CSKARUKUSA-N |
| XLogP | 3.68 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.18 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|