C15H24BN3O2 — CID 74789351
(1S)-1-[2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-4-pyridinyl]ethane-1,2-diamine (PubChem CID 74789351) has the molecular formula C15H24BN3O2 and a molecular weight of 289.19 g/mol. Its IUPAC name is (1S)-1-[2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-4-pyridinyl]ethane-1,2-diamine.
| Compound Name | (1S)-1-[2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-4-pyridinyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 74789351 |
| Molecular Formula | C15H24BN3O2 |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (1S)-1-[2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-4-pyridinyl]ethane-1,2-diamine |
| SMILES | CC1(C)OB(/C=C/c2cc([C@H](N)CN)ccn2)OC1(C)C |
| InChI | InChI=1S/C15H24BN3O2/c1-14(2)15(3,4)21-16(20-14)7-5-12-9-11(6-8-19-12)13(18)10-17/h5-9,13H,10,17-18H2,1-4H3/b7-5+/t13-/m1/s1 |
| InChIKey | FKTOBRVPQFAWHD-VUDGCMKMSA-N |
| XLogP | 1.68 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|