C15H19BN2O2 — CID 57416716
6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-pyrrolo[3,2-c]pyridine (PubChem CID 57416716) has the molecular formula C15H19BN2O2 and a molecular weight of 270.14 g/mol. Its IUPAC name is 6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-pyrrolo[3,2-c]pyridine.
| Compound Name | 6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 57416716 |
| Molecular Formula | C15H19BN2O2 |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-pyrrolo[3,2-c]pyridine |
| SMILES | CC1(C)OB(/C=C/c2cc3[nH]ccc3cn2)OC1(C)C |
| InChI | InChI=1S/C15H19BN2O2/c1-14(2)15(3,4)20-16(19-14)7-5-12-9-13-11(10-18-12)6-8-17-13/h5-10,17H,1-4H3/b7-5+ |
| InChIKey | DETJSRAAXPHKED-FNORWQNLSA-N |
| XLogP | 3.21 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|