C16H20BNO2 — CID 175224614
6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-indole (PubChem CID 175224614) has the molecular formula C16H20BNO2 and a molecular weight of 269.15 g/mol. Its IUPAC name is 6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-indole.
| Compound Name | 6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-indole |
|---|---|
| PubChem CID | 175224614 |
| Molecular Formula | C16H20BNO2 |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1H-indole |
| SMILES | CC1(C)OB(/C=C/c2ccc3cc[nH]c3c2)OC1(C)C |
| InChI | InChI=1S/C16H20BNO2/c1-15(2)16(3,4)20-17(19-15)9-7-12-5-6-13-8-10-18-14(13)11-12/h5-11,18H,1-4H3/b9-7+ |
| InChIKey | SMBVMNRVBJPNTP-VQHVLOKHSA-N |
| XLogP | 3.81 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|