About 1H-indole-6-carbaldehyde;methoxymethane
1H-indole-6-carbaldehyde;methoxymethane (PubChem CID 142993125) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 1H-indole-6-carbaldehyde;methoxymethane.
Molecular Properties
| Compound Name | 1H-indole-6-carbaldehyde;methoxymethane |
| PubChem CID | 142993125 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 1H-indole-6-carbaldehyde;methoxymethane |
| SMILES | COC.O=Cc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C9H7NO.C2H6O/c11-6-7-1-2-8-3-4-10-9(8)5-7;1-3-2/h1-6,10H;1-2H3 |
| InChIKey | ZJZMIQMLYIKNIC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole-6-carbaldehyde;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole-6-carbaldehyde;methoxymethane?
The IUPAC name of 1H-indole-6-carbaldehyde;methoxymethane (CID 142993125) is 1H-indole-6-carbaldehyde;methoxymethane.
What is the SMILES notation for 1H-indole-6-carbaldehyde;methoxymethane?
The canonical SMILES for 1H-indole-6-carbaldehyde;methoxymethane is COC.O=Cc1ccc2cc[nH]c2c1.
What is the InChIKey of 1H-indole-6-carbaldehyde;methoxymethane?
The InChIKey is ZJZMIQMLYIKNIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C2H6O/c11-6-7-1-2-8-3-4-10-9(8)5-7;1-3-2/h1-6,10H;1-2H3.
What are the key properties of 1H-indole-6-carbaldehyde;methoxymethane?
1H-indole-6-carbaldehyde;methoxymethane has a molecular weight of 191.23 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole-6-carbaldehyde;methoxymethane is sourced from PubChem (CID 142993125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).