C20H24BNO2 — CID 168897718
4-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]aniline (PubChem CID 168897718) has the molecular formula C20H24BNO2 and a molecular weight of 321.23 g/mol. Its IUPAC name is 4-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]aniline.
| Compound Name | 4-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 168897718 |
| Molecular Formula | C20H24BNO2 |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 4-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]aniline |
| SMILES | CC1(C)OB(/C=C/c2ccc(-c3ccc(N)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C20H24BNO2/c1-19(2)20(3,4)24-21(23-19)14-13-15-5-7-16(8-6-15)17-9-11-18(22)12-10-17/h5-14H,22H2,1-4H3/b14-13+ |
| InChIKey | TUHSZLZMDLBGQF-BUHFOSPRSA-N |
| XLogP | 4.58 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|