C19H29BN2O2 — CID 58486288
1-methyl-4-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]piperazine (PubChem CID 58486288) has the molecular formula C19H29BN2O2 and a molecular weight of 328.26 g/mol. Its IUPAC name is 1-methyl-4-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]piperazine.
| Compound Name | 1-methyl-4-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]piperazine |
|---|---|
| PubChem CID | 58486288 |
| Molecular Formula | C19H29BN2O2 |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 1-methyl-4-[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]piperazine |
| SMILES | CN1CCN(c2ccc(/C=C/B3OC(C)(C)C(C)(C)O3)cc2)CC1 |
| InChI | InChI=1S/C19H29BN2O2/c1-18(2)19(3,4)24-20(23-18)11-10-16-6-8-17(9-7-16)22-14-12-21(5)13-15-22/h6-11H,12-15H2,1-5H3/b11-10+ |
| InChIKey | ZQJAGYQZKKFDEF-ZHACJKMWSA-N |
| XLogP | 3.08 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|