C17H31BO4 — CID 53304621
[(E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enyl] 2,2-dimethylpropanoate (PubChem CID 53304621) has the molecular formula C17H31BO4 and a molecular weight of 310.24 g/mol. Its IUPAC name is [(E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 53304621 |
| Molecular Formula | C17H31BO4 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | [(E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCCC/C=C/B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H31BO4/c1-15(2,3)14(19)20-13-11-9-8-10-12-18-21-16(4,5)17(6,7)22-18/h10,12H,8-9,11,13H2,1-7H3/b12-10+ |
| InChIKey | LKYKEONIHVQXMA-ZRDIBKRKSA-N |
| XLogP | 3.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|