C18H34BNO6 — CID 175221498
[3,3-dimethyl-1-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoxy]ethoxy]butan-2-yl] carbamate (PubChem CID 175221498) has the molecular formula C18H34BNO6 and a molecular weight of 371.28 g/mol. Its IUPAC name is [3,3-dimethyl-1-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoxy]ethoxy]butan-2-yl] carbamate.
| Compound Name | [3,3-dimethyl-1-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoxy]ethoxy]butan-2-yl] carbamate |
|---|---|
| PubChem CID | 175221498 |
| Molecular Formula | C18H34BNO6 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | [3,3-dimethyl-1-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoxy]ethoxy]butan-2-yl] carbamate |
| SMILES | CC(C)(C)C(COCCOCC=CB1OC(C)(C)C(C)(C)O1)OC(N)=O |
| InChI | InChI=1S/C18H34BNO6/c1-16(2,3)14(24-15(20)21)13-23-12-11-22-10-8-9-19-25-17(4,5)18(6,7)26-19/h8-9,14H,10-13H2,1-7H3,(H2,20,21) |
| InChIKey | GAJOAAZSTZVXHQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|