C16H27BO3 — CID 140959268
2-[(E)-3-[(2E)-2,4-dimethylpenta-2,4-dienoxy]prop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 140959268) has the molecular formula C16H27BO3 and a molecular weight of 278.20 g/mol. Its IUPAC name is 2-[(E)-3-[(2E)-2,4-dimethylpenta-2,4-dienoxy]prop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(E)-3-[(2E)-2,4-dimethylpenta-2,4-dienoxy]prop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 140959268 |
| Molecular Formula | C16H27BO3 |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-[(E)-3-[(2E)-2,4-dimethylpenta-2,4-dienoxy]prop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C(C)/C=C(\C)COC/C=C/B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H27BO3/c1-13(2)11-14(3)12-18-10-8-9-17-19-15(4,5)16(6,7)20-17/h8-9,11H,1,10,12H2,2-7H3/b9-8+,14-11+ |
| InChIKey | GUSRNGWDKQWEFN-HUKVCQRGSA-N |
| XLogP | 3.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|