C11H24N2O4 — CID 175096885
[1-[2-(2-aminoethoxy)ethoxy]-3,3-dimethylbutan-2-yl] carbamate (PubChem CID 175096885) has the molecular formula C11H24N2O4 and a molecular weight of 248.32 g/mol. Its IUPAC name is [1-[2-(2-aminoethoxy)ethoxy]-3,3-dimethylbutan-2-yl] carbamate.
| Compound Name | [1-[2-(2-aminoethoxy)ethoxy]-3,3-dimethylbutan-2-yl] carbamate |
|---|---|
| PubChem CID | 175096885 |
| Molecular Formula | C11H24N2O4 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | [1-[2-(2-aminoethoxy)ethoxy]-3,3-dimethylbutan-2-yl] carbamate |
| SMILES | CC(C)(C)C(COCCOCCN)OC(N)=O |
| InChI | InChI=1S/C11H24N2O4/c1-11(2,3)9(17-10(13)14)8-16-7-6-15-5-4-12/h9H,4-8,12H2,1-3H3,(H2,13,14) |
| InChIKey | COKJMRBCZOISFQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|