C16H34N2O5 — CID 175808420
2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[(2S)-3,3-dimethylbutan-2-yl]acetamide (PubChem CID 175808420) has the molecular formula C16H34N2O5 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[(2S)-3,3-dimethylbutan-2-yl]acetamide.
| Compound Name | 2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[(2S)-3,3-dimethylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 175808420 |
| Molecular Formula | C16H34N2O5 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[(2S)-3,3-dimethylbutan-2-yl]acetamide |
| SMILES | C[C@H](NC(=O)COCCOCCOCCOCCN)C(C)(C)C |
| InChI | InChI=1S/C16H34N2O5/c1-14(16(2,3)4)18-15(19)13-23-12-11-22-10-9-21-8-7-20-6-5-17/h14H,5-13,17H2,1-4H3,(H,18,19)/t14-/m0/s1 |
| InChIKey | GJNKWWUOFBCMJZ-AWEZNQCLSA-N |
| XLogP | 0.56 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|