C9H20N2O2S — CID 115740075
2-(2-aminoethoxy)-N-(4-methylsulfanylbutan-2-yl)acetamide (PubChem CID 115740075) has the molecular formula C9H20N2O2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N-(4-methylsulfanylbutan-2-yl)acetamide.
| Compound Name | 2-(2-aminoethoxy)-N-(4-methylsulfanylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 115740075 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-(2-aminoethoxy)-N-(4-methylsulfanylbutan-2-yl)acetamide |
| SMILES | CSCCC(C)NC(=O)COCCN |
| InChI | InChI=1S/C9H20N2O2S/c1-8(3-6-14-2)11-9(12)7-13-5-4-10/h8H,3-7,10H2,1-2H3,(H,11,12) |
| InChIKey | DFYOQZTZZMICNN-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|