C16H37NO3 — CID 142338769
1-[2-(2-aminoethoxy)ethoxy]butan-2-one;2,3-dimethylbutane;ethane (PubChem CID 142338769) has the molecular formula C16H37NO3 and a molecular weight of 291.48 g/mol. Its IUPAC name is 1-[2-(2-aminoethoxy)ethoxy]butan-2-one;2,3-dimethylbutane;ethane.
| Compound Name | 1-[2-(2-aminoethoxy)ethoxy]butan-2-one;2,3-dimethylbutane;ethane |
|---|---|
| PubChem CID | 142338769 |
| Molecular Formula | C16H37NO3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.28 |
| IUPAC Name | 1-[2-(2-aminoethoxy)ethoxy]butan-2-one;2,3-dimethylbutane;ethane |
| SMILES | CC.CC(C)C(C)C.CCC(=O)COCCOCCN |
| InChI | InChI=1S/C8H17NO3.C6H14.C2H6/c1-2-8(10)7-12-6-5-11-4-3-9;1-5(2)6(3)4;1-2/h2-7,9H2,1H3;5-6H,1-4H3;1-2H3 |
| InChIKey | CSGLDRWIBMBVQP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|