C15H29NO6 — CID 138726748
2-[2-[2-[2-(2-oxobutoxy)ethoxy]ethoxy]ethoxy]-N-propan-2-ylacetamide (PubChem CID 138726748) has the molecular formula C15H29NO6 and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-oxobutoxy)ethoxy]ethoxy]ethoxy]-N-propan-2-ylacetamide.
| Compound Name | 2-[2-[2-[2-(2-oxobutoxy)ethoxy]ethoxy]ethoxy]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 138726748 |
| Molecular Formula | C15H29NO6 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 2-[2-[2-[2-(2-oxobutoxy)ethoxy]ethoxy]ethoxy]-N-propan-2-ylacetamide |
| SMILES | CCC(=O)COCCOCCOCCOCC(=O)NC(C)C |
| InChI | InChI=1S/C15H29NO6/c1-4-14(17)11-21-9-7-19-5-6-20-8-10-22-12-15(18)16-13(2)3/h13H,4-12H2,1-3H3,(H,16,18) |
| InChIKey | CMJGJZZLSZBGKP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|