C18H34BNO2 — CID 177175036
(4Z)-2,3,3,7-tetramethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-4,7-dien-2-amine (PubChem CID 177175036) has the molecular formula C18H34BNO2 and a molecular weight of 307.29 g/mol. Its IUPAC name is (4Z)-2,3,3,7-tetramethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-4,7-dien-2-amine.
| Compound Name | (4Z)-2,3,3,7-tetramethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-4,7-dien-2-amine |
|---|---|
| PubChem CID | 177175036 |
| Molecular Formula | C18H34BNO2 |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.27 |
| IUPAC Name | (4Z)-2,3,3,7-tetramethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-4,7-dien-2-amine |
| SMILES | C=C(C)C/C(=C\C(C)(C)C(C)(C)N)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H34BNO2/c1-13(2)11-14(12-15(3,4)16(5,6)20)19-21-17(7,8)18(9,10)22-19/h12H,1,11,20H2,2-10H3/b14-12+ |
| InChIKey | RDXWQPBQGDASLC-WYMLVPIESA-N |
| XLogP | 4.27 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|